C22H29N5O4 — CID 30280139
(3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl 3-(dimethylamino)benzoate (PubChem CID 30280139) has the molecular formula C22H29N5O4 and a molecular weight of 427.51 g/mol. Its IUPAC name is (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl 3-(dimethylamino)benzoate.
| Compound Name | (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl 3-(dimethylamino)benzoate |
|---|---|
| PubChem CID | 30280139 |
| Molecular Formula | C22H29N5O4 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl 3-(dimethylamino)benzoate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)c1cccc(N(C)C)c1)n2CCC |
| InChI | InChI=1S/C22H29N5O4/c1-5-7-12-27-19-18(20(28)24-22(27)30)26(11-6-2)17(23-19)14-31-21(29)15-9-8-10-16(13-15)25(3)4/h8-10,13H,5-7,11-12,14H2,1-4H3,(H,24,28,30) |
| InChIKey | QPYQKFJODFERBN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |