C22H28N4O5 — CID 46606539
(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 4-propan-2-yloxybenzoate (PubChem CID 46606539) has the molecular formula C22H28N4O5 and a molecular weight of 428.49 g/mol. Its IUPAC name is (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 4-propan-2-yloxybenzoate.
| Compound Name | (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 4-propan-2-yloxybenzoate |
|---|---|
| PubChem CID | 46606539 |
| Molecular Formula | C22H28N4O5 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 4-propan-2-yloxybenzoate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)c1ccc(OC(C)C)cc1)n2CC |
| InChI | InChI=1S/C22H28N4O5/c1-5-7-12-26-19-18(20(27)24-22(26)29)25(6-2)17(23-19)13-30-21(28)15-8-10-16(11-9-15)31-14(3)4/h8-11,14H,5-7,12-13H2,1-4H3,(H,24,27,29) |
| InChIKey | GBWTUYCZBCWSOQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |