C23H30N4O5 — CID 46605878
(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 4-(4-methylphenoxy)butanoate (PubChem CID 46605878) has the molecular formula C23H30N4O5 and a molecular weight of 442.52 g/mol. Its IUPAC name is (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 4-(4-methylphenoxy)butanoate.
| Compound Name | (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 4-(4-methylphenoxy)butanoate |
|---|---|
| PubChem CID | 46605878 |
| Molecular Formula | C23H30N4O5 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 4-(4-methylphenoxy)butanoate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)CCCOc1ccc(C)cc1)n2CC |
| InChI | InChI=1S/C23H30N4O5/c1-4-6-13-27-21-20(22(29)25-23(27)30)26(5-2)18(24-21)15-32-19(28)8-7-14-31-17-11-9-16(3)10-12-17/h9-12H,4-8,13-15H2,1-3H3,(H,25,29,30) |
| InChIKey | MUFLHYAEWKIRCY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|