C23H28N4O5S — CID 158494327
5-[4-[(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methoxy]phenyl]thiolane-3-carboxylic acid (PubChem CID 158494327) has the molecular formula C23H28N4O5S and a molecular weight of 472.57 g/mol. Its IUPAC name is 5-[4-[(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methoxy]phenyl]thiolane-3-carboxylic acid.
| Compound Name | 5-[4-[(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methoxy]phenyl]thiolane-3-carboxylic acid |
|---|---|
| PubChem CID | 158494327 |
| Molecular Formula | C23H28N4O5S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 5-[4-[(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methoxy]phenyl]thiolane-3-carboxylic acid |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COc1ccc(C3CC(C(=O)O)CS3)cc1)n2CC |
| InChI | InChI=1S/C23H28N4O5S/c1-3-5-10-27-20-19(21(28)25-23(27)31)26(4-2)18(24-20)12-32-16-8-6-14(7-9-16)17-11-15(13-33-17)22(29)30/h6-9,15,17H,3-5,10-13H2,1-2H3,(H,29,30)(H,25,28,31) |
| InChIKey | HJBXISYOQVDEOM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |