C18H22N4O4S — CID 55397427
(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 2-thiophen-2-ylacetate (PubChem CID 55397427) has the molecular formula C18H22N4O4S and a molecular weight of 390.47 g/mol. Its IUPAC name is (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 2-thiophen-2-ylacetate.
| Compound Name | (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 2-thiophen-2-ylacetate |
|---|---|
| PubChem CID | 55397427 |
| Molecular Formula | C18H22N4O4S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 2-thiophen-2-ylacetate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)Cc1cccs1)n2CC |
| InChI | InChI=1S/C18H22N4O4S/c1-3-5-8-22-16-15(17(24)20-18(22)25)21(4-2)13(19-16)11-26-14(23)10-12-7-6-9-27-12/h6-7,9H,3-5,8,10-11H2,1-2H3,(H,20,24,25) |
| InChIKey | CLPDHYPLPHZSTC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |