C21H26N4O4 — CID 55402728
(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 2-(4-methylphenyl)acetate (PubChem CID 55402728) has the molecular formula C21H26N4O4 and a molecular weight of 398.46 g/mol. Its IUPAC name is (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 2-(4-methylphenyl)acetate.
| Compound Name | (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 2-(4-methylphenyl)acetate |
|---|---|
| PubChem CID | 55402728 |
| Molecular Formula | C21H26N4O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 2-(4-methylphenyl)acetate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)Cc1ccc(C)cc1)n2CC |
| InChI | InChI=1S/C21H26N4O4/c1-4-6-11-25-19-18(20(27)23-21(25)28)24(5-2)16(22-19)13-29-17(26)12-15-9-7-14(3)8-10-15/h7-10H,4-6,11-13H2,1-3H3,(H,23,27,28) |
| InChIKey | OIUDWELUHWFWPP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |