C19H20Cl2N4O4 — CID 55394010
(3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 2-(3,4-dichlorophenyl)acetate (PubChem CID 55394010) has the molecular formula C19H20Cl2N4O4 and a molecular weight of 439.30 g/mol. Its IUPAC name is (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 2-(3,4-dichlorophenyl)acetate.
| Compound Name | (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 2-(3,4-dichlorophenyl)acetate |
|---|---|
| PubChem CID | 55394010 |
| Molecular Formula | C19H20Cl2N4O4 |
| Molecular Weight | 439.30 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 2-(3,4-dichlorophenyl)acetate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)Cc1ccc(Cl)c(Cl)c1)n2C |
| InChI | InChI=1S/C19H20Cl2N4O4/c1-3-4-7-25-17-16(18(27)23-19(25)28)24(2)14(22-17)10-29-15(26)9-11-5-6-12(20)13(21)8-11/h5-6,8H,3-4,7,9-10H2,1-2H3,(H,23,27,28) |
| InChIKey | MQDAPCFIPGVOMJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |