C20H21ClN4O4 — CID 7504022
(3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl (E)-3-(4-chlorophenyl)prop-2-enoate (PubChem CID 7504022) has the molecular formula C20H21ClN4O4 and a molecular weight of 416.87 g/mol. Its IUPAC name is (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl (E)-3-(4-chlorophenyl)prop-2-enoate.
| Compound Name | (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl (E)-3-(4-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7504022 |
| Molecular Formula | C20H21ClN4O4 |
| Molecular Weight | 416.87 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl (E)-3-(4-chlorophenyl)prop-2-enoate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)/C=C/c1ccc(Cl)cc1)n2C |
| InChI | InChI=1S/C20H21ClN4O4/c1-3-4-11-25-18-17(19(27)23-20(25)28)24(2)15(22-18)12-29-16(26)10-7-13-5-8-14(21)9-6-13/h5-10H,3-4,11-12H2,1-2H3,(H,23,27,28)/b10-7+ |
| InChIKey | BQSFLVYWPIRPDY-JXMROGBWSA-N |
| XLogP | 2.63 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.87 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|