C20H24N4O6S — CID 55404246
(3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 2-ethylsulfonylbenzoate (PubChem CID 55404246) has the molecular formula C20H24N4O6S and a molecular weight of 448.50 g/mol. Its IUPAC name is (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 2-ethylsulfonylbenzoate.
| Compound Name | (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 2-ethylsulfonylbenzoate |
|---|---|
| PubChem CID | 55404246 |
| Molecular Formula | C20H24N4O6S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 2-ethylsulfonylbenzoate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)c1ccccc1S(=O)(=O)CC)n2C |
| InChI | InChI=1S/C20H24N4O6S/c1-4-6-11-24-17-16(18(25)22-20(24)27)23(3)15(21-17)12-30-19(26)13-9-7-8-10-14(13)31(28,29)5-2/h7-10H,4-6,11-12H2,1-3H3,(H,22,25,27) |
| InChIKey | ZIACWAROLFFWFP-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 133.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |