C24H27N5O6 — CID 55399536
(3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 2-butyl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 55399536) has the molecular formula C24H27N5O6 and a molecular weight of 481.51 g/mol. Its IUPAC name is (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 2-butyl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 2-butyl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 55399536 |
| Molecular Formula | C24H27N5O6 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 2-butyl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCCCN1C(=O)c2ccc(C(=O)OCc3nc4c(c(=O)[nH]c(=O)n4CCCC)n3C)cc2C1=O |
| InChI | InChI=1S/C24H27N5O6/c1-4-6-10-28-19-18(20(30)26-24(28)34)27(3)17(25-19)13-35-23(33)14-8-9-15-16(12-14)22(32)29(21(15)31)11-7-5-2/h8-9,12H,4-7,10-11,13H2,1-3H3,(H,26,30,34) |
| InChIKey | GYIBWHIRFVVZRE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 136.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|