C20H24N4O4 — CID 7503989
(3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 4-ethylbenzoate (PubChem CID 7503989) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 4-ethylbenzoate.
| Compound Name | (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 4-ethylbenzoate |
|---|---|
| PubChem CID | 7503989 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 4-ethylbenzoate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)c1ccc(CC)cc1)n2C |
| InChI | InChI=1S/C20H24N4O4/c1-4-6-11-24-17-16(18(25)22-20(24)27)23(3)15(21-17)12-28-19(26)14-9-7-13(5-2)8-10-14/h7-10H,4-6,11-12H2,1-3H3,(H,22,25,27) |
| InChIKey | CZHMEFJKXNMTGI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |