C20H24N4O4 — CID 4791325
(3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl benzoate (PubChem CID 4791325) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl benzoate.
| Compound Name | (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl benzoate |
|---|---|
| PubChem CID | 4791325 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl benzoate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)c1ccccc1)n2CCC |
| InChI | InChI=1S/C20H24N4O4/c1-3-5-12-24-17-16(18(25)22-20(24)27)23(11-4-2)15(21-17)13-28-19(26)14-9-7-6-8-10-14/h6-10H,3-5,11-13H2,1-2H3,(H,22,25,27) |
| InChIKey | PTDWPUMAWVYNPE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |