C21H27N5O5 — CID 4881060
(3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl N-(2-methoxyphenyl)carbamate (PubChem CID 4881060) has the molecular formula C21H27N5O5 and a molecular weight of 429.48 g/mol. Its IUPAC name is (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl N-(2-methoxyphenyl)carbamate.
| Compound Name | (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl N-(2-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 4881060 |
| Molecular Formula | C21H27N5O5 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl N-(2-methoxyphenyl)carbamate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)Nc1ccccc1OC)n2CCC |
| InChI | InChI=1S/C21H27N5O5/c1-4-6-12-26-18-17(19(27)24-20(26)28)25(11-5-2)16(23-18)13-31-21(29)22-14-9-7-8-10-15(14)30-3/h7-10H,4-6,11-13H2,1-3H3,(H,22,29)(H,24,27,28) |
| InChIKey | NMMLGZIZWLVUMI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |