C24H33N5O4 — CID 26914779
3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)-N-(2-methoxyphenyl)propanamide (PubChem CID 26914779) has the molecular formula C24H33N5O4 and a molecular weight of 455.56 g/mol. Its IUPAC name is 3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)-N-(2-methoxyphenyl)propanamide.
| Compound Name | 3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)-N-(2-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 26914779 |
| Molecular Formula | C24H33N5O4 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | 3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)-N-(2-methoxyphenyl)propanamide |
| SMILES | CCCCCn1c(CCC(=O)Nc2ccccc2OC)nc2c1c(=O)[nH]c(=O)n2CCCC |
| InChI | InChI=1S/C24H33N5O4/c1-4-6-10-16-28-19(13-14-20(30)25-17-11-8-9-12-18(17)33-3)26-22-21(28)23(31)27-24(32)29(22)15-7-5-2/h8-9,11-12H,4-7,10,13-16H2,1-3H3,(H,25,30)(H,27,31,32) |
| InChIKey | VVHGGJQPOQNUNF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|