C25H33N5O5 — CID 26098092
methyl 4-[3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)propanoylamino]benzoate (PubChem CID 26098092) has the molecular formula C25H33N5O5 and a molecular weight of 483.57 g/mol. Its IUPAC name is methyl 4-[3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)propanoylamino]benzoate.
| Compound Name | methyl 4-[3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)propanoylamino]benzoate |
|---|---|
| PubChem CID | 26098092 |
| Molecular Formula | C25H33N5O5 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | methyl 4-[3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)propanoylamino]benzoate |
| SMILES | CCCCCn1c(CCC(=O)Nc2ccc(C(=O)OC)cc2)nc2c1c(=O)[nH]c(=O)n2CCCC |
| InChI | InChI=1S/C25H33N5O5/c1-4-6-8-16-29-19(27-22-21(29)23(32)28-25(34)30(22)15-7-5-2)13-14-20(31)26-18-11-9-17(10-12-18)24(33)35-3/h9-12H,4-8,13-16H2,1-3H3,(H,26,31)(H,28,32,34) |
| InChIKey | ADMDMTLHOMRKTE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|