C26H35N5O3 — CID 26864801
3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)-N-(2,3-dihydro-1H-inden-5-yl)propanamide (PubChem CID 26864801) has the molecular formula C26H35N5O3 and a molecular weight of 465.60 g/mol. Its IUPAC name is 3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)-N-(2,3-dihydro-1H-inden-5-yl)propanamide.
| Compound Name | 3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)-N-(2,3-dihydro-1H-inden-5-yl)propanamide |
|---|---|
| PubChem CID | 26864801 |
| Molecular Formula | C26H35N5O3 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | 3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)-N-(2,3-dihydro-1H-inden-5-yl)propanamide |
| SMILES | CCCCCn1c(CCC(=O)Nc2ccc3c(c2)CCC3)nc2c1c(=O)[nH]c(=O)n2CCCC |
| InChI | InChI=1S/C26H35N5O3/c1-3-5-7-16-30-21(28-24-23(30)25(33)29-26(34)31(24)15-6-4-2)13-14-22(32)27-20-12-11-18-9-8-10-19(18)17-20/h11-12,17H,3-10,13-16H2,1-2H3,(H,27,32)(H,29,33,34) |
| InChIKey | FJIVEANAMJWOKJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|