C23H32N6O3 — CID 27554231
3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)-N-(pyridin-2-ylmethyl)propanamide (PubChem CID 27554231) has the molecular formula C23H32N6O3 and a molecular weight of 440.55 g/mol. Its IUPAC name is 3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)-N-(pyridin-2-ylmethyl)propanamide.
| Compound Name | 3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)-N-(pyridin-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 27554231 |
| Molecular Formula | C23H32N6O3 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | 3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)-N-(pyridin-2-ylmethyl)propanamide |
| SMILES | CCCCCn1c(CCC(=O)NCc2ccccn2)nc2c1c(=O)[nH]c(=O)n2CCCC |
| InChI | InChI=1S/C23H32N6O3/c1-3-5-9-15-28-18(11-12-19(30)25-16-17-10-7-8-13-24-17)26-21-20(28)22(31)27-23(32)29(21)14-6-4-2/h7-8,10,13H,3-6,9,11-12,14-16H2,1-2H3,(H,25,30)(H,27,31,32) |
| InChIKey | MPOFJXIKDDVLBM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|