C27H40N6O3 — CID 27897949
3-[3-butyl-7-(2-methylpropyl)-2,6-dioxopurin-8-yl]-N-[3-(N-ethylanilino)propyl]propanamide (PubChem CID 27897949) has the molecular formula C27H40N6O3 and a molecular weight of 496.66 g/mol. Its IUPAC name is 3-[3-butyl-7-(2-methylpropyl)-2,6-dioxopurin-8-yl]-N-[3-(N-ethylanilino)propyl]propanamide.
| Compound Name | 3-[3-butyl-7-(2-methylpropyl)-2,6-dioxopurin-8-yl]-N-[3-(N-ethylanilino)propyl]propanamide |
|---|---|
| PubChem CID | 27897949 |
| Molecular Formula | C27H40N6O3 |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.32 |
| IUPAC Name | 3-[3-butyl-7-(2-methylpropyl)-2,6-dioxopurin-8-yl]-N-[3-(N-ethylanilino)propyl]propanamide |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(CCC(=O)NCCCN(CC)c1ccccc1)n2CC(C)C |
| InChI | InChI=1S/C27H40N6O3/c1-5-7-18-32-25-24(26(35)30-27(32)36)33(19-20(3)4)22(29-25)14-15-23(34)28-16-11-17-31(6-2)21-12-9-8-10-13-21/h8-10,12-13,20H,5-7,11,14-19H2,1-4H3,(H,28,34)(H,30,35,36) |
| InChIKey | BNBBBQRSADFRNA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|