C23H30N4O4 — CID 41350760
benzyl 3-[3-butyl-7-(2-methylpropyl)-2,6-dioxopurin-8-yl]propanoate (PubChem CID 41350760) has the molecular formula C23H30N4O4 and a molecular weight of 426.52 g/mol. Its IUPAC name is benzyl 3-[3-butyl-7-(2-methylpropyl)-2,6-dioxopurin-8-yl]propanoate.
| Compound Name | benzyl 3-[3-butyl-7-(2-methylpropyl)-2,6-dioxopurin-8-yl]propanoate |
|---|---|
| PubChem CID | 41350760 |
| Molecular Formula | C23H30N4O4 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | benzyl 3-[3-butyl-7-(2-methylpropyl)-2,6-dioxopurin-8-yl]propanoate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(CCC(=O)OCc1ccccc1)n2CC(C)C |
| InChI | InChI=1S/C23H30N4O4/c1-4-5-13-26-21-20(22(29)25-23(26)30)27(14-16(2)3)18(24-21)11-12-19(28)31-15-17-9-7-6-8-10-17/h6-10,16H,4-5,11-15H2,1-3H3,(H,25,29,30) |
| InChIKey | FVCKSBKHNMWUFA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |