C22H26F3N5O3 — CID 26357819
3-[3-butyl-7-(2-methylpropyl)-2,6-dioxopurin-8-yl]-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 26357819) has the molecular formula C22H26F3N5O3 and a molecular weight of 465.48 g/mol. Its IUPAC name is 3-[3-butyl-7-(2-methylpropyl)-2,6-dioxopurin-8-yl]-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | 3-[3-butyl-7-(2-methylpropyl)-2,6-dioxopurin-8-yl]-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 26357819 |
| Molecular Formula | C22H26F3N5O3 |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | 3-[3-butyl-7-(2-methylpropyl)-2,6-dioxopurin-8-yl]-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(CCC(=O)Nc1ccc(F)c(F)c1F)n2CC(C)C |
| InChI | InChI=1S/C22H26F3N5O3/c1-4-5-10-29-20-19(21(32)28-22(29)33)30(11-12(2)3)15(27-20)8-9-16(31)26-14-7-6-13(23)17(24)18(14)25/h6-7,12H,4-5,8-11H2,1-3H3,(H,26,31)(H,28,32,33) |
| InChIKey | YYTGHAXLHHNTAY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|