C24H33N7O5 — CID 41262267
3-[3-butyl-7-(2-methylpropyl)-2,6-dioxopurin-8-yl]-N-[2-(4-nitroanilino)ethyl]propanamide (PubChem CID 41262267) has the molecular formula C24H33N7O5 and a molecular weight of 499.57 g/mol. Its IUPAC name is 3-[3-butyl-7-(2-methylpropyl)-2,6-dioxopurin-8-yl]-N-[2-(4-nitroanilino)ethyl]propanamide.
| Compound Name | 3-[3-butyl-7-(2-methylpropyl)-2,6-dioxopurin-8-yl]-N-[2-(4-nitroanilino)ethyl]propanamide |
|---|---|
| PubChem CID | 41262267 |
| Molecular Formula | C24H33N7O5 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | 3-[3-butyl-7-(2-methylpropyl)-2,6-dioxopurin-8-yl]-N-[2-(4-nitroanilino)ethyl]propanamide |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(CCC(=O)NCCNc1ccc([N+](=O)[O-])cc1)n2CC(C)C |
| InChI | InChI=1S/C24H33N7O5/c1-4-5-14-29-22-21(23(33)28-24(29)34)30(15-16(2)3)19(27-22)10-11-20(32)26-13-12-25-17-6-8-18(9-7-17)31(35)36/h6-9,16,25H,4-5,10-15H2,1-3H3,(H,26,32)(H,28,33,34) |
| InChIKey | ZXDNGSKFALTWLU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 156.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|