C24H33N5O3 — CID 43025464
3-[3-butyl-7-(2-methylpropyl)-2,6-dioxopurin-8-yl]-N-ethyl-N-phenylpropanamide (PubChem CID 43025464) has the molecular formula C24H33N5O3 and a molecular weight of 439.56 g/mol. Its IUPAC name is 3-[3-butyl-7-(2-methylpropyl)-2,6-dioxopurin-8-yl]-N-ethyl-N-phenylpropanamide.
| Compound Name | 3-[3-butyl-7-(2-methylpropyl)-2,6-dioxopurin-8-yl]-N-ethyl-N-phenylpropanamide |
|---|---|
| PubChem CID | 43025464 |
| Molecular Formula | C24H33N5O3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | 3-[3-butyl-7-(2-methylpropyl)-2,6-dioxopurin-8-yl]-N-ethyl-N-phenylpropanamide |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(CCC(=O)N(CC)c1ccccc1)n2CC(C)C |
| InChI | InChI=1S/C24H33N5O3/c1-5-7-15-28-22-21(23(31)26-24(28)32)29(16-17(3)4)19(25-22)13-14-20(30)27(6-2)18-11-9-8-10-12-18/h8-12,17H,5-7,13-16H2,1-4H3,(H,26,31,32) |
| InChIKey | PWXQGDYMTACJKM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 92.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |