C23H39N5O3 — CID 35824765
N-butyl-3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)-N-ethylpropanamide (PubChem CID 35824765) has the molecular formula C23H39N5O3 and a molecular weight of 433.60 g/mol. Its IUPAC name is N-butyl-3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)-N-ethylpropanamide.
| Compound Name | N-butyl-3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)-N-ethylpropanamide |
|---|---|
| PubChem CID | 35824765 |
| Molecular Formula | C23H39N5O3 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.31 |
| IUPAC Name | N-butyl-3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)-N-ethylpropanamide |
| SMILES | CCCCCn1c(CCC(=O)N(CC)CCCC)nc2c1c(=O)[nH]c(=O)n2CCCC |
| InChI | InChI=1S/C23H39N5O3/c1-5-9-12-17-27-18(13-14-19(29)26(8-4)15-10-6-2)24-21-20(27)22(30)25-23(31)28(21)16-11-7-3/h5-17H2,1-4H3,(H,25,30,31) |
| InChIKey | OPNIZERUBBSADV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 92.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|