C25H33N5O4 — CID 32612261
3-butyl-8-[3-(2,3-dihydro-1,4-benzoxazin-4-yl)-3-oxopropyl]-7-pentylpurine-2,6-dione (PubChem CID 32612261) has the molecular formula C25H33N5O4 and a molecular weight of 467.57 g/mol. Its IUPAC name is 3-butyl-8-[3-(2,3-dihydro-1,4-benzoxazin-4-yl)-3-oxopropyl]-7-pentylpurine-2,6-dione.
| Compound Name | 3-butyl-8-[3-(2,3-dihydro-1,4-benzoxazin-4-yl)-3-oxopropyl]-7-pentylpurine-2,6-dione |
|---|---|
| PubChem CID | 32612261 |
| Molecular Formula | C25H33N5O4 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | 3-butyl-8-[3-(2,3-dihydro-1,4-benzoxazin-4-yl)-3-oxopropyl]-7-pentylpurine-2,6-dione |
| SMILES | CCCCCn1c(CCC(=O)N2CCOc3ccccc32)nc2c1c(=O)[nH]c(=O)n2CCCC |
| InChI | InChI=1S/C25H33N5O4/c1-3-5-9-15-29-20(26-23-22(29)24(32)27-25(33)30(23)14-6-4-2)12-13-21(31)28-16-17-34-19-11-8-7-10-18(19)28/h7-8,10-11H,3-6,9,12-17H2,1-2H3,(H,27,32,33) |
| InChIKey | ZWWRWPVZXAUOSC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|