C23H37N5O4 — CID 43059045
3-butyl-8-[3-(2-ethylmorpholin-4-yl)-3-oxopropyl]-7-pentylpurine-2,6-dione (PubChem CID 43059045) has the molecular formula C23H37N5O4 and a molecular weight of 447.58 g/mol. Its IUPAC name is 3-butyl-8-[3-(2-ethylmorpholin-4-yl)-3-oxopropyl]-7-pentylpurine-2,6-dione.
| Compound Name | 3-butyl-8-[3-(2-ethylmorpholin-4-yl)-3-oxopropyl]-7-pentylpurine-2,6-dione |
|---|---|
| PubChem CID | 43059045 |
| Molecular Formula | C23H37N5O4 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.28 |
| IUPAC Name | 3-butyl-8-[3-(2-ethylmorpholin-4-yl)-3-oxopropyl]-7-pentylpurine-2,6-dione |
| SMILES | CCCCCn1c(CCC(=O)N2CCOC(CC)C2)nc2c1c(=O)[nH]c(=O)n2CCCC |
| InChI | InChI=1S/C23H37N5O4/c1-4-7-9-13-27-18(10-11-19(29)26-14-15-32-17(6-3)16-26)24-21-20(27)22(30)25-23(31)28(21)12-8-5-2/h17H,4-16H2,1-3H3,(H,25,30,31) |
| InChIKey | QVBFOJKDCWZVSS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|