C25H41N5O3 — CID 43057444
3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)-N-(cyclohexylmethyl)-N-methylpropanamide (PubChem CID 43057444) has the molecular formula C25H41N5O3 and a molecular weight of 459.64 g/mol. Its IUPAC name is 3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)-N-(cyclohexylmethyl)-N-methylpropanamide.
| Compound Name | 3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)-N-(cyclohexylmethyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 43057444 |
| Molecular Formula | C25H41N5O3 |
| Molecular Weight | 459.64 g/mol |
| Exact Mass | 459.32 |
| IUPAC Name | 3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)-N-(cyclohexylmethyl)-N-methylpropanamide |
| SMILES | CCCCCn1c(CCC(=O)N(C)CC2CCCCC2)nc2c1c(=O)[nH]c(=O)n2CCCC |
| InChI | InChI=1S/C25H41N5O3/c1-4-6-11-17-29-20(14-15-21(31)28(3)18-19-12-9-8-10-13-19)26-23-22(29)24(32)27-25(33)30(23)16-7-5-2/h19H,4-18H2,1-3H3,(H,27,32,33) |
| InChIKey | UBPLJDNSZXUVPR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 92.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.64 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|