C15H21N4O4- — CID 7024303
3-(7-butyl-2,6-dioxo-3-propylpurin-8-yl)propanoate (PubChem CID 7024303) has the molecular formula C15H21N4O4- and a molecular weight of 321.36 g/mol. Its IUPAC name is 3-(7-butyl-2,6-dioxo-3-propylpurin-8-yl)propanoate.
| Compound Name | 3-(7-butyl-2,6-dioxo-3-propylpurin-8-yl)propanoate |
|---|---|
| PubChem CID | 7024303 |
| Molecular Formula | C15H21N4O4- |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 3-(7-butyl-2,6-dioxo-3-propylpurin-8-yl)propanoate |
| SMILES | CCCCn1c(CCC(=O)[O-])nc2c1c(=O)[nH]c(=O)n2CCC |
| InChI | InChI=1S/C15H22N4O4/c1-3-5-9-18-10(6-7-11(20)21)16-13-12(18)14(22)17-15(23)19(13)8-4-2/h3-9H2,1-2H3,(H,20,21)(H,17,22,23)/p-1 |
| InChIKey | AZSRKOPFSMYYEH-UHFFFAOYSA-M |
| XLogP | -0.22 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |