C16H24N4O4 — CID 7503949
(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl butanoate (PubChem CID 7503949) has the molecular formula C16H24N4O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl butanoate.
| Compound Name | (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl butanoate |
|---|---|
| PubChem CID | 7503949 |
| Molecular Formula | C16H24N4O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl butanoate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)CCC)n2CC |
| InChI | InChI=1S/C16H24N4O4/c1-4-7-9-20-14-13(15(22)18-16(20)23)19(6-3)11(17-14)10-24-12(21)8-5-2/h4-10H2,1-3H3,(H,18,22,23) |
| InChIKey | ZCNXENAGIKBPAZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |