C23H29N5O6 — CID 46606135
(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 2-[(2-ethoxybenzoyl)amino]acetate (PubChem CID 46606135) has the molecular formula C23H29N5O6 and a molecular weight of 471.51 g/mol. Its IUPAC name is (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 2-[(2-ethoxybenzoyl)amino]acetate.
| Compound Name | (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 2-[(2-ethoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 46606135 |
| Molecular Formula | C23H29N5O6 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 2-[(2-ethoxybenzoyl)amino]acetate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)CNC(=O)c1ccccc1OCC)n2CC |
| InChI | InChI=1S/C23H29N5O6/c1-4-7-12-28-20-19(22(31)26-23(28)32)27(5-2)17(25-20)14-34-18(29)13-24-21(30)15-10-8-9-11-16(15)33-6-3/h8-11H,4-7,12-14H2,1-3H3,(H,24,30)(H,26,31,32) |
| InChIKey | RNJLUMOGZHHSHL-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 137.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |