C18H21FN4O3 — CID 51214746
3-butyl-7-ethyl-8-[(2-fluorophenoxy)methyl]purine-2,6-dione (PubChem CID 51214746) has the molecular formula C18H21FN4O3 and a molecular weight of 360.39 g/mol. Its IUPAC name is 3-butyl-7-ethyl-8-[(2-fluorophenoxy)methyl]purine-2,6-dione.
| Compound Name | 3-butyl-7-ethyl-8-[(2-fluorophenoxy)methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 51214746 |
| Molecular Formula | C18H21FN4O3 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 3-butyl-7-ethyl-8-[(2-fluorophenoxy)methyl]purine-2,6-dione |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COc1ccccc1F)n2CC |
| InChI | InChI=1S/C18H21FN4O3/c1-3-5-10-23-16-15(17(24)21-18(23)25)22(4-2)14(20-16)11-26-13-9-7-6-8-12(13)19/h6-9H,3-5,10-11H2,1-2H3,(H,21,24,25) |
| InChIKey | UTIVCNUDQGQFKM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |