C21H24N6O2S — CID 55547298
3-butyl-7-ethyl-8-[(5-phenyl-1H-imidazol-2-yl)sulfanylmethyl]purine-2,6-dione (PubChem CID 55547298) has the molecular formula C21H24N6O2S and a molecular weight of 424.53 g/mol. Its IUPAC name is 3-butyl-7-ethyl-8-[(5-phenyl-1H-imidazol-2-yl)sulfanylmethyl]purine-2,6-dione.
| Compound Name | 3-butyl-7-ethyl-8-[(5-phenyl-1H-imidazol-2-yl)sulfanylmethyl]purine-2,6-dione |
|---|---|
| PubChem CID | 55547298 |
| Molecular Formula | C21H24N6O2S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 3-butyl-7-ethyl-8-[(5-phenyl-1H-imidazol-2-yl)sulfanylmethyl]purine-2,6-dione |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(CSc1ncc(-c3ccccc3)[nH]1)n2CC |
| InChI | InChI=1S/C21H24N6O2S/c1-3-5-11-27-18-17(19(28)25-21(27)29)26(4-2)16(24-18)13-30-20-22-12-15(23-20)14-9-7-6-8-10-14/h6-10,12H,3-5,11,13H2,1-2H3,(H,22,23)(H,25,28,29) |
| InChIKey | JIKNWFZCOLVFQT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 101.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |