C27H29N7O2S — CID 166695479
3-butyl-8-[(5,6-diphenyl-1,6-dihydro-1,2,4-triazin-3-yl)sulfanylmethyl]-7-ethylpurine-2,6-dione (PubChem CID 166695479) has the molecular formula C27H29N7O2S and a molecular weight of 515.64 g/mol. Its IUPAC name is 3-butyl-8-[(5,6-diphenyl-1,6-dihydro-1,2,4-triazin-3-yl)sulfanylmethyl]-7-ethylpurine-2,6-dione.
| Compound Name | 3-butyl-8-[(5,6-diphenyl-1,6-dihydro-1,2,4-triazin-3-yl)sulfanylmethyl]-7-ethylpurine-2,6-dione |
|---|---|
| PubChem CID | 166695479 |
| Molecular Formula | C27H29N7O2S |
| Molecular Weight | 515.64 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | 3-butyl-8-[(5,6-diphenyl-1,6-dihydro-1,2,4-triazin-3-yl)sulfanylmethyl]-7-ethylpurine-2,6-dione |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(CSC1=NNC(c3ccccc3)C(c3ccccc3)=N1)n2CC |
| InChI | InChI=1S/C27H29N7O2S/c1-3-5-16-34-24-23(25(35)30-27(34)36)33(4-2)20(28-24)17-37-26-29-21(18-12-8-6-9-13-18)22(31-32-26)19-14-10-7-11-15-19/h6-15,22,31H,3-5,16-17H2,1-2H3,(H,30,35,36) |
| InChIKey | RTNSCKOANCIMGU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 109.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.64 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |