C23H22F3N5O2S — CID 24558255
3-benzyl-7-butyl-8-[[5-(trifluoromethyl)-2-pyridinyl]sulfanylmethyl]purine-2,6-dione (PubChem CID 24558255) has the molecular formula C23H22F3N5O2S and a molecular weight of 489.52 g/mol. Its IUPAC name is 3-benzyl-7-butyl-8-[[5-(trifluoromethyl)-2-pyridinyl]sulfanylmethyl]purine-2,6-dione.
| Compound Name | 3-benzyl-7-butyl-8-[[5-(trifluoromethyl)-2-pyridinyl]sulfanylmethyl]purine-2,6-dione |
|---|---|
| PubChem CID | 24558255 |
| Molecular Formula | C23H22F3N5O2S |
| Molecular Weight | 489.52 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 3-benzyl-7-butyl-8-[[5-(trifluoromethyl)-2-pyridinyl]sulfanylmethyl]purine-2,6-dione |
| SMILES | CCCCn1c(CSc2ccc(C(F)(F)F)cn2)nc2c1c(=O)[nH]c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C23H22F3N5O2S/c1-2-3-11-30-17(14-34-18-10-9-16(12-27-18)23(24,25)26)28-20-19(30)21(32)29-22(33)31(20)13-15-7-5-4-6-8-15/h4-10,12H,2-3,11,13-14H2,1H3,(H,29,32,33) |
| InChIKey | URNAPGIBYDTVMN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 85.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.52 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |