C25H27N5O3S — CID 24558135
N-[4-[(3-benzyl-7-butyl-2,6-dioxopurin-8-yl)methylsulfanyl]phenyl]acetamide (PubChem CID 24558135) has the molecular formula C25H27N5O3S and a molecular weight of 477.59 g/mol. Its IUPAC name is N-[4-[(3-benzyl-7-butyl-2,6-dioxopurin-8-yl)methylsulfanyl]phenyl]acetamide.
| Compound Name | N-[4-[(3-benzyl-7-butyl-2,6-dioxopurin-8-yl)methylsulfanyl]phenyl]acetamide |
|---|---|
| PubChem CID | 24558135 |
| Molecular Formula | C25H27N5O3S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | N-[4-[(3-benzyl-7-butyl-2,6-dioxopurin-8-yl)methylsulfanyl]phenyl]acetamide |
| SMILES | CCCCn1c(CSc2ccc(NC(C)=O)cc2)nc2c1c(=O)[nH]c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C25H27N5O3S/c1-3-4-14-29-21(16-34-20-12-10-19(11-13-20)26-17(2)31)27-23-22(29)24(32)28-25(33)30(23)15-18-8-6-5-7-9-18/h5-13H,3-4,14-16H2,1-2H3,(H,26,31)(H,28,32,33) |
| InChIKey | LMPHXPGVICPFRB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |