C19H22N8O2S — CID 55442431
8-[(1-benzyltetrazol-5-yl)sulfanylmethyl]-3-butyl-7-methylpurine-2,6-dione (PubChem CID 55442431) has the molecular formula C19H22N8O2S and a molecular weight of 426.51 g/mol. Its IUPAC name is 8-[(1-benzyltetrazol-5-yl)sulfanylmethyl]-3-butyl-7-methylpurine-2,6-dione.
| Compound Name | 8-[(1-benzyltetrazol-5-yl)sulfanylmethyl]-3-butyl-7-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 55442431 |
| Molecular Formula | C19H22N8O2S |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 8-[(1-benzyltetrazol-5-yl)sulfanylmethyl]-3-butyl-7-methylpurine-2,6-dione |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(CSc1nnnn1Cc1ccccc1)n2C |
| InChI | InChI=1S/C19H22N8O2S/c1-3-4-10-26-16-15(17(28)21-18(26)29)25(2)14(20-16)12-30-19-22-23-24-27(19)11-13-8-6-5-7-9-13/h5-9H,3-4,10-12H2,1-2H3,(H,21,28,29) |
| InChIKey | TVUNJGAQFRPIMT-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 116.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |