C21H24N6O4 — CID 55411870
3-butyl-7-methyl-8-[(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)methyl]purine-2,6-dione (PubChem CID 55411870) has the molecular formula C21H24N6O4 and a molecular weight of 424.46 g/mol. Its IUPAC name is 3-butyl-7-methyl-8-[(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)methyl]purine-2,6-dione.
| Compound Name | 3-butyl-7-methyl-8-[(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 55411870 |
| Molecular Formula | C21H24N6O4 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 3-butyl-7-methyl-8-[(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)methyl]purine-2,6-dione |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(CN1C(=O)NC(C)(c3ccccc3)C1=O)n2C |
| InChI | InChI=1S/C21H24N6O4/c1-4-5-11-26-16-15(17(28)23-19(26)30)25(3)14(22-16)12-27-18(29)21(2,24-20(27)31)13-9-7-6-8-10-13/h6-10H,4-5,11-12H2,1-3H3,(H,24,31)(H,23,28,30) |
| InChIKey | LUEONKQBCDNZPX-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|