C22H25ClN6O4 — CID 55412528
3-butyl-8-[[4-(4-chlorophenyl)-4-ethyl-2,5-dioxoimidazolidin-1-yl]methyl]-7-methylpurine-2,6-dione (PubChem CID 55412528) has the molecular formula C22H25ClN6O4 and a molecular weight of 472.93 g/mol. Its IUPAC name is 3-butyl-8-[[4-(4-chlorophenyl)-4-ethyl-2,5-dioxoimidazolidin-1-yl]methyl]-7-methylpurine-2,6-dione.
| Compound Name | 3-butyl-8-[[4-(4-chlorophenyl)-4-ethyl-2,5-dioxoimidazolidin-1-yl]methyl]-7-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 55412528 |
| Molecular Formula | C22H25ClN6O4 |
| Molecular Weight | 472.93 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 3-butyl-8-[[4-(4-chlorophenyl)-4-ethyl-2,5-dioxoimidazolidin-1-yl]methyl]-7-methylpurine-2,6-dione |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(CN1C(=O)NC(CC)(c3ccc(Cl)cc3)C1=O)n2C |
| InChI | InChI=1S/C22H25ClN6O4/c1-4-6-11-28-17-16(18(30)25-20(28)32)27(3)15(24-17)12-29-19(31)22(5-2,26-21(29)33)13-7-9-14(23)10-8-13/h7-10H,4-6,11-12H2,1-3H3,(H,26,33)(H,25,30,32) |
| InChIKey | FPJKPVDLGMLANC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.93 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|