C15H16ClN7O2 — CID 47011236
5-(4-chlorophenyl)-3-[(4,6-diamino-1,3,5-triazin-2-yl)methyl]-5-ethylimidazolidine-2,4-dione (PubChem CID 47011236) has the molecular formula C15H16ClN7O2 and a molecular weight of 361.79 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-[(4,6-diamino-1,3,5-triazin-2-yl)methyl]-5-ethylimidazolidine-2,4-dione.
| Compound Name | 5-(4-chlorophenyl)-3-[(4,6-diamino-1,3,5-triazin-2-yl)methyl]-5-ethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 47011236 |
| Molecular Formula | C15H16ClN7O2 |
| Molecular Weight | 361.79 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 5-(4-chlorophenyl)-3-[(4,6-diamino-1,3,5-triazin-2-yl)methyl]-5-ethylimidazolidine-2,4-dione |
| SMILES | CCC1(c2ccc(Cl)cc2)NC(=O)N(Cc2nc(N)nc(N)n2)C1=O |
| InChI | InChI=1S/C15H16ClN7O2/c1-2-15(8-3-5-9(16)6-4-8)11(24)23(14(25)22-15)7-10-19-12(17)21-13(18)20-10/h3-6H,2,7H2,1H3,(H,22,25)(H4,17,18,19,20,21) |
| InChIKey | JIXGGQNYMPVHJD-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 140.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.79 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|