C14H15ClN2O2 — CID 97026004
(5R)-5-(4-chlorophenyl)-5-ethyl-3-prop-2-enylimidazolidine-2,4-dione (PubChem CID 97026004) has the molecular formula C14H15ClN2O2 and a molecular weight of 278.74 g/mol. Its IUPAC name is (5R)-5-(4-chlorophenyl)-5-ethyl-3-prop-2-enylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-(4-chlorophenyl)-5-ethyl-3-prop-2-enylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 97026004 |
| Molecular Formula | C14H15ClN2O2 |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | (5R)-5-(4-chlorophenyl)-5-ethyl-3-prop-2-enylimidazolidine-2,4-dione |
| SMILES | C=CCN1C(=O)N[C@](CC)(c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C14H15ClN2O2/c1-3-9-17-12(18)14(4-2,16-13(17)19)10-5-7-11(15)8-6-10/h3,5-8H,1,4,9H2,2H3,(H,16,19)/t14-/m1/s1 |
| InChIKey | CYCTUDXPJUXJHF-CQSZACIVSA-N |
| XLogP | 2.68 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|