C22H25ClN2O3 — CID 18272138
5-(4-chlorophenyl)-3-[3-(3,5-dimethylphenoxy)propyl]-5-ethylimidazolidine-2,4-dione (PubChem CID 18272138) has the molecular formula C22H25ClN2O3 and a molecular weight of 400.91 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-[3-(3,5-dimethylphenoxy)propyl]-5-ethylimidazolidine-2,4-dione.
| Compound Name | 5-(4-chlorophenyl)-3-[3-(3,5-dimethylphenoxy)propyl]-5-ethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 18272138 |
| Molecular Formula | C22H25ClN2O3 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 5-(4-chlorophenyl)-3-[3-(3,5-dimethylphenoxy)propyl]-5-ethylimidazolidine-2,4-dione |
| SMILES | CCC1(c2ccc(Cl)cc2)NC(=O)N(CCCOc2cc(C)cc(C)c2)C1=O |
| InChI | InChI=1S/C22H25ClN2O3/c1-4-22(17-6-8-18(23)9-7-17)20(26)25(21(27)24-22)10-5-11-28-19-13-15(2)12-16(3)14-19/h6-9,12-14H,4-5,10-11H2,1-3H3,(H,24,27) |
| InChIKey | SAGPFXQLQLTEMJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|