C20H26N4O3 — CID 97243668
(5R)-3-[3-(3,5-dimethylphenoxy)propyl]-5-ethyl-5-(1-methylpyrazol-4-yl)imidazolidine-2,4-dione (PubChem CID 97243668) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is (5R)-3-[3-(3,5-dimethylphenoxy)propyl]-5-ethyl-5-(1-methylpyrazol-4-yl)imidazolidine-2,4-dione.
| Compound Name | (5R)-3-[3-(3,5-dimethylphenoxy)propyl]-5-ethyl-5-(1-methylpyrazol-4-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 97243668 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | (5R)-3-[3-(3,5-dimethylphenoxy)propyl]-5-ethyl-5-(1-methylpyrazol-4-yl)imidazolidine-2,4-dione |
| SMILES | CC[C@]1(c2cnn(C)c2)NC(=O)N(CCCOc2cc(C)cc(C)c2)C1=O |
| InChI | InChI=1S/C20H26N4O3/c1-5-20(16-12-21-23(4)13-16)18(25)24(19(26)22-20)7-6-8-27-17-10-14(2)9-15(3)11-17/h9-13H,5-8H2,1-4H3,(H,22,26)/t20-/m1/s1 |
| InChIKey | FHCGDNHUSGNFHP-HXUWFJFHSA-N |
| XLogP | 2.66 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|