C21H22N4O3 — CID 99707844
(5R)-5-methyl-5-(1-methylpyrazol-4-yl)-3-(3-naphthalen-2-yloxypropyl)imidazolidine-2,4-dione (PubChem CID 99707844) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is (5R)-5-methyl-5-(1-methylpyrazol-4-yl)-3-(3-naphthalen-2-yloxypropyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-methyl-5-(1-methylpyrazol-4-yl)-3-(3-naphthalen-2-yloxypropyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 99707844 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | (5R)-5-methyl-5-(1-methylpyrazol-4-yl)-3-(3-naphthalen-2-yloxypropyl)imidazolidine-2,4-dione |
| SMILES | Cn1cc([C@@]2(C)NC(=O)N(CCCOc3ccc4ccccc4c3)C2=O)cn1 |
| InChI | InChI=1S/C21H22N4O3/c1-21(17-13-22-24(2)14-17)19(26)25(20(27)23-21)10-5-11-28-18-9-8-15-6-3-4-7-16(15)12-18/h3-4,6-9,12-14H,5,10-11H2,1-2H3,(H,23,27)/t21-/m1/s1 |
| InChIKey | TUJNDMRIUZPCHS-OAQYLSRUSA-N |
| XLogP | 2.81 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|