C24H30N2O3 — CID 18267863
5-(4-tert-butylphenyl)-5-methyl-3-[3-(3-methylphenoxy)propyl]imidazolidine-2,4-dione (PubChem CID 18267863) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)-5-methyl-3-[3-(3-methylphenoxy)propyl]imidazolidine-2,4-dione.
| Compound Name | 5-(4-tert-butylphenyl)-5-methyl-3-[3-(3-methylphenoxy)propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 18267863 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 5-(4-tert-butylphenyl)-5-methyl-3-[3-(3-methylphenoxy)propyl]imidazolidine-2,4-dione |
| SMILES | Cc1cccc(OCCCN2C(=O)NC(C)(c3ccc(C(C)(C)C)cc3)C2=O)c1 |
| InChI | InChI=1S/C24H30N2O3/c1-17-8-6-9-20(16-17)29-15-7-14-26-21(27)24(5,25-22(26)28)19-12-10-18(11-13-19)23(2,3)4/h6,8-13,16H,7,14-15H2,1-5H3,(H,25,28) |
| InChIKey | QVRWTDFKWJPHMF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|