C21H25N3O2 — CID 75858248
5-(4-tert-butylphenyl)-5-methyl-3-(2-pyridin-4-ylethyl)imidazolidine-2,4-dione (PubChem CID 75858248) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)-5-methyl-3-(2-pyridin-4-ylethyl)imidazolidine-2,4-dione.
| Compound Name | 5-(4-tert-butylphenyl)-5-methyl-3-(2-pyridin-4-ylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 75858248 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 5-(4-tert-butylphenyl)-5-methyl-3-(2-pyridin-4-ylethyl)imidazolidine-2,4-dione |
| SMILES | CC(C)(C)c1ccc(C2(C)NC(=O)N(CCc3ccncc3)C2=O)cc1 |
| InChI | InChI=1S/C21H25N3O2/c1-20(2,3)16-5-7-17(8-6-16)21(4)18(25)24(19(26)23-21)14-11-15-9-12-22-13-10-15/h5-10,12-13H,11,14H2,1-4H3,(H,23,26) |
| InChIKey | SQIXRJKSSYOSRH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|