C20H19F3N2O4 — CID 52517969
(5R)-5-methyl-3-[2-(4-methylphenoxy)ethyl]-5-[4-(trifluoromethoxy)phenyl]imidazolidine-2,4-dione (PubChem CID 52517969) has the molecular formula C20H19F3N2O4 and a molecular weight of 408.38 g/mol. Its IUPAC name is (5R)-5-methyl-3-[2-(4-methylphenoxy)ethyl]-5-[4-(trifluoromethoxy)phenyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-methyl-3-[2-(4-methylphenoxy)ethyl]-5-[4-(trifluoromethoxy)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 52517969 |
| Molecular Formula | C20H19F3N2O4 |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | (5R)-5-methyl-3-[2-(4-methylphenoxy)ethyl]-5-[4-(trifluoromethoxy)phenyl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc(OCCN2C(=O)N[C@](C)(c3ccc(OC(F)(F)F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C20H19F3N2O4/c1-13-3-7-15(8-4-13)28-12-11-25-17(26)19(2,24-18(25)27)14-5-9-16(10-6-14)29-20(21,22)23/h3-10H,11-12H2,1-2H3,(H,24,27)/t19-/m1/s1 |
| InChIKey | DMHWJWWIZIEMDZ-LJQANCHMSA-N |
| XLogP | 3.74 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|