C19H19FN2O5S — CID 56684439
3-[2-(4-fluorophenoxy)ethyl]-5-methyl-5-(4-methylsulfonylphenyl)imidazolidine-2,4-dione (PubChem CID 56684439) has the molecular formula C19H19FN2O5S and a molecular weight of 406.44 g/mol. Its IUPAC name is 3-[2-(4-fluorophenoxy)ethyl]-5-methyl-5-(4-methylsulfonylphenyl)imidazolidine-2,4-dione.
| Compound Name | 3-[2-(4-fluorophenoxy)ethyl]-5-methyl-5-(4-methylsulfonylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 56684439 |
| Molecular Formula | C19H19FN2O5S |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 3-[2-(4-fluorophenoxy)ethyl]-5-methyl-5-(4-methylsulfonylphenyl)imidazolidine-2,4-dione |
| SMILES | CC1(c2ccc(S(C)(=O)=O)cc2)NC(=O)N(CCOc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C19H19FN2O5S/c1-19(13-3-9-16(10-4-13)28(2,25)26)17(23)22(18(24)21-19)11-12-27-15-7-5-14(20)6-8-15/h3-10H,11-12H2,1-2H3,(H,21,24) |
| InChIKey | ZKTZCOBSUNPFJF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|