C18H16ClFN2O3 — CID 40745064
(5R)-5-(2-chlorophenyl)-3-[2-(4-fluorophenoxy)ethyl]-5-methylimidazolidine-2,4-dione (PubChem CID 40745064) has the molecular formula C18H16ClFN2O3 and a molecular weight of 362.79 g/mol. Its IUPAC name is (5R)-5-(2-chlorophenyl)-3-[2-(4-fluorophenoxy)ethyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-(2-chlorophenyl)-3-[2-(4-fluorophenoxy)ethyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 40745064 |
| Molecular Formula | C18H16ClFN2O3 |
| Molecular Weight | 362.79 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | (5R)-5-(2-chlorophenyl)-3-[2-(4-fluorophenoxy)ethyl]-5-methylimidazolidine-2,4-dione |
| SMILES | C[C@]1(c2ccccc2Cl)NC(=O)N(CCOc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C18H16ClFN2O3/c1-18(14-4-2-3-5-15(14)19)16(23)22(17(24)21-18)10-11-25-13-8-6-12(20)7-9-13/h2-9H,10-11H2,1H3,(H,21,24)/t18-/m1/s1 |
| InChIKey | PDDDQGBOLMGULG-GOSISDBHSA-N |
| XLogP | 3.33 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.79 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|