C18H15ClF2N2O3 — CID 7562071
(5R)-3-[2-(4-chlorophenoxy)ethyl]-5-(2,5-difluorophenyl)-5-methylimidazolidine-2,4-dione (PubChem CID 7562071) has the molecular formula C18H15ClF2N2O3 and a molecular weight of 380.78 g/mol. Its IUPAC name is (5R)-3-[2-(4-chlorophenoxy)ethyl]-5-(2,5-difluorophenyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[2-(4-chlorophenoxy)ethyl]-5-(2,5-difluorophenyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 7562071 |
| Molecular Formula | C18H15ClF2N2O3 |
| Molecular Weight | 380.78 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | (5R)-3-[2-(4-chlorophenoxy)ethyl]-5-(2,5-difluorophenyl)-5-methylimidazolidine-2,4-dione |
| SMILES | C[C@]1(c2cc(F)ccc2F)NC(=O)N(CCOc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C18H15ClF2N2O3/c1-18(14-10-12(20)4-7-15(14)21)16(24)23(17(25)22-18)8-9-26-13-5-2-11(19)3-6-13/h2-7,10H,8-9H2,1H3,(H,22,25)/t18-/m1/s1 |
| InChIKey | WDLGTYPMZNYEKY-GOSISDBHSA-N |
| XLogP | 3.46 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.78 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|