C19H16ClN3O3 — CID 60617429
3-[1-[2-(4-chlorophenoxy)ethyl]-4-methyl-2,5-dioxoimidazolidin-4-yl]benzonitrile (PubChem CID 60617429) has the molecular formula C19H16ClN3O3 and a molecular weight of 369.81 g/mol. Its IUPAC name is 3-[1-[2-(4-chlorophenoxy)ethyl]-4-methyl-2,5-dioxoimidazolidin-4-yl]benzonitrile.
| Compound Name | 3-[1-[2-(4-chlorophenoxy)ethyl]-4-methyl-2,5-dioxoimidazolidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 60617429 |
| Molecular Formula | C19H16ClN3O3 |
| Molecular Weight | 369.81 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 3-[1-[2-(4-chlorophenoxy)ethyl]-4-methyl-2,5-dioxoimidazolidin-4-yl]benzonitrile |
| SMILES | CC1(c2cccc(C#N)c2)NC(=O)N(CCOc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C19H16ClN3O3/c1-19(14-4-2-3-13(11-14)12-21)17(24)23(18(25)22-19)9-10-26-16-7-5-15(20)6-8-16/h2-8,11H,9-10H2,1H3,(H,22,25) |
| InChIKey | FVMUASMGJWXZIB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.81 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|