C16H13F3N4O3 — CID 166222460
5-methyl-3-(pyrimidin-2-ylmethyl)-5-[4-(trifluoromethoxy)phenyl]imidazolidine-2,4-dione (PubChem CID 166222460) has the molecular formula C16H13F3N4O3 and a molecular weight of 366.30 g/mol. Its IUPAC name is 5-methyl-3-(pyrimidin-2-ylmethyl)-5-[4-(trifluoromethoxy)phenyl]imidazolidine-2,4-dione.
| Compound Name | 5-methyl-3-(pyrimidin-2-ylmethyl)-5-[4-(trifluoromethoxy)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 166222460 |
| Molecular Formula | C16H13F3N4O3 |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 5-methyl-3-(pyrimidin-2-ylmethyl)-5-[4-(trifluoromethoxy)phenyl]imidazolidine-2,4-dione |
| SMILES | CC1(c2ccc(OC(F)(F)F)cc2)NC(=O)N(Cc2ncccn2)C1=O |
| InChI | InChI=1S/C16H13F3N4O3/c1-15(10-3-5-11(6-4-10)26-16(17,18)19)13(24)23(14(25)22-15)9-12-20-7-2-8-21-12/h2-8H,9H2,1H3,(H,22,25) |
| InChIKey | HJUVNZMSMHPMRI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|